C24H33N3O4S — CID 23953477
(5S,6R,7S)-6-N-benzyl-3-(3-hydroxypropyl)-9-methyl-4-oxo-2-N-propan-2-yl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23953477) has the molecular formula C24H33N3O4S and a molecular weight of 459.61 g/mol. Its IUPAC name is (5S,6R,7S)-6-N-benzyl-3-(3-hydroxypropyl)-9-methyl-4-oxo-2-N-propan-2-yl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-6-N-benzyl-3-(3-hydroxypropyl)-9-methyl-4-oxo-2-N-propan-2-yl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23953477 |
| Molecular Formula | C24H33N3O4S |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | (5S,6R,7S)-6-N-benzyl-3-(3-hydroxypropyl)-9-methyl-4-oxo-2-N-propan-2-yl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CC(C)NC(=O)C1N(CCCO)C(=O)[C@@H]2[C@H](C(=O)NCc3ccccc3)[C@@H]3CC(C)C12S3 |
| InChI | InChI=1S/C24H33N3O4S/c1-14(2)26-22(30)20-24-15(3)12-17(32-24)18(19(24)23(31)27(20)10-7-11-28)21(29)25-13-16-8-5-4-6-9-16/h4-6,8-9,14-15,17-20,28H,7,10-13H2,1-3H3,(H,25,29)(H,26,30)/t15?,17-,18+,19-,20?,24?/m0/s1 |
| InChIKey | RCQVRINVZUQYCP-HVWYRTKISA-N |
| XLogP | 1.55 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |