C30H43BrN4O6S — CID 23897731
(5S,6R,7R)-8-bromo-6-N-(4-ethoxyphenyl)-3-(6-hydroxyhexyl)-2-N-(2-morpholin-4-ylethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23897731) has the molecular formula C30H43BrN4O6S and a molecular weight of 667.67 g/mol. Its IUPAC name is (5S,6R,7R)-8-bromo-6-N-(4-ethoxyphenyl)-3-(6-hydroxyhexyl)-2-N-(2-morpholin-4-ylethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7R)-8-bromo-6-N-(4-ethoxyphenyl)-3-(6-hydroxyhexyl)-2-N-(2-morpholin-4-ylethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23897731 |
| Molecular Formula | C30H43BrN4O6S |
| Molecular Weight | 667.67 g/mol |
| Exact Mass | 666.21 |
| IUPAC Name | (5S,6R,7R)-8-bromo-6-N-(4-ethoxyphenyl)-3-(6-hydroxyhexyl)-2-N-(2-morpholin-4-ylethyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@H]2[C@H]3C(=O)N(CCCCCCO)C(C(=O)NCCN4CCOCC4)C34CC(Br)[C@@H]2S4)cc1 |
| InChI | InChI=1S/C30H43BrN4O6S/c1-2-41-21-9-7-20(8-10-21)33-27(37)23-24-29(39)35(12-5-3-4-6-16-36)26(30(24)19-22(31)25(23)42-30)28(38)32-11-13-34-14-17-40-18-15-34/h7-10,22-26,36H,2-6,11-19H2,1H3,(H,32,38)(H,33,37)/t22?,23-,24-,25-,26?,30?/m0/s1 |
| InChIKey | OHBOBNLASPWNCT-DVMXDDCXSA-N |
| XLogP | 2.49 |
| TPSA | 120.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.67 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|