C23H29BrClN3O5 — CID 23784496
(5R,6S,7R)-8-bromo-2-N-(2-chloro-6-methylphenyl)-3-(5-hydroxypentyl)-6-N-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23784496) has the molecular formula C23H29BrClN3O5 and a molecular weight of 542.86 g/mol. Its IUPAC name is (5R,6S,7R)-8-bromo-2-N-(2-chloro-6-methylphenyl)-3-(5-hydroxypentyl)-6-N-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7R)-8-bromo-2-N-(2-chloro-6-methylphenyl)-3-(5-hydroxypentyl)-6-N-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23784496 |
| Molecular Formula | C23H29BrClN3O5 |
| Molecular Weight | 542.86 g/mol |
| Exact Mass | 541.10 |
| IUPAC Name | (5R,6S,7R)-8-bromo-2-N-(2-chloro-6-methylphenyl)-3-(5-hydroxypentyl)-6-N-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CNC(=O)[C@H]1[C@H]2C(=O)N(CCCCCO)C(C(=O)Nc3c(C)cccc3Cl)C23CC(Br)[C@@H]1O3 |
| InChI | InChI=1S/C23H29BrClN3O5/c1-12-7-6-8-14(25)17(12)27-21(31)19-23-11-13(24)18(33-23)15(20(30)26-2)16(23)22(32)28(19)9-4-3-5-10-29/h6-8,13,15-16,18-19,29H,3-5,9-11H2,1-2H3,(H,26,30)(H,27,31)/t13?,15-,16-,18-,19?,23?/m0/s1 |
| InChIKey | QEJCCGTWVXAURZ-UCPBXHAGSA-N |
| XLogP | 2.24 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.86 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|