C29H35N3O5 — CID 23753448
(5R,6S,7S)-2-N-benzyl-3-(6-hydroxyhexyl)-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23753448) has the molecular formula C29H35N3O5 and a molecular weight of 505.62 g/mol. Its IUPAC name is (5R,6S,7S)-2-N-benzyl-3-(6-hydroxyhexyl)-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-2-N-benzyl-3-(6-hydroxyhexyl)-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23753448 |
| Molecular Formula | C29H35N3O5 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.26 |
| IUPAC Name | (5R,6S,7S)-2-N-benzyl-3-(6-hydroxyhexyl)-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | O=C(NCc1ccccc1)C1N(CCCCCCO)C(=O)[C@@H]2[C@H](C(=O)Nc3ccccc3)[C@@H]3CCC12O3 |
| InChI | InChI=1S/C29H35N3O5/c33-18-10-2-1-9-17-32-25(27(35)30-19-20-11-5-3-6-12-20)29-16-15-22(37-29)23(24(29)28(32)36)26(34)31-21-13-7-4-8-14-21/h3-8,11-14,22-25,33H,1-2,9-10,15-19H2,(H,30,35)(H,31,34)/t22-,23+,24-,25?,29?/m0/s1 |
| InChIKey | NSGFAAUKPWNXBS-CRLPVRABSA-N |
| XLogP | 2.87 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|