C32H41BrN4O4S — CID 23953590
(5S,6R,7R)-6-N-benzyl-8-bromo-2-N-[4-(diethylamino)phenyl]-3-(5-hydroxypentyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23953590) has the molecular formula C32H41BrN4O4S and a molecular weight of 657.68 g/mol. Its IUPAC name is (5S,6R,7R)-6-N-benzyl-8-bromo-2-N-[4-(diethylamino)phenyl]-3-(5-hydroxypentyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7R)-6-N-benzyl-8-bromo-2-N-[4-(diethylamino)phenyl]-3-(5-hydroxypentyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23953590 |
| Molecular Formula | C32H41BrN4O4S |
| Molecular Weight | 657.68 g/mol |
| Exact Mass | 656.20 |
| IUPAC Name | (5S,6R,7R)-6-N-benzyl-8-bromo-2-N-[4-(diethylamino)phenyl]-3-(5-hydroxypentyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)C2N(CCCCCO)C(=O)[C@@H]3[C@H](C(=O)NCc4ccccc4)[C@H]4SC23CC4Br)cc1 |
| InChI | InChI=1S/C32H41BrN4O4S/c1-3-36(4-2)23-15-13-22(14-16-23)35-30(40)28-32-19-24(33)27(42-32)25(29(39)34-20-21-11-7-5-8-12-21)26(32)31(41)37(28)17-9-6-10-18-38/h5,7-8,11-16,24-28,38H,3-4,6,9-10,17-20H2,1-2H3,(H,34,39)(H,35,40)/t24?,25-,26-,27-,28?,32?/m0/s1 |
| InChIKey | HUBGEOMRORDBRD-VQWOVJBJSA-N |
| XLogP | 4.41 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.68 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|