C27H38BrN3O4S — CID 23869741
(5S,6R,7R)-8-bromo-2-N-(2,5-dimethylphenyl)-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-4-oxo-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23869741) has the molecular formula C27H38BrN3O4S and a molecular weight of 580.59 g/mol. Its IUPAC name is (5S,6R,7R)-8-bromo-2-N-(2,5-dimethylphenyl)-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-4-oxo-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7R)-8-bromo-2-N-(2,5-dimethylphenyl)-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-4-oxo-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23869741 |
| Molecular Formula | C27H38BrN3O4S |
| Molecular Weight | 580.59 g/mol |
| Exact Mass | 579.18 |
| IUPAC Name | (5S,6R,7R)-8-bromo-2-N-(2,5-dimethylphenyl)-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-4-oxo-6-N-propyl-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCCNC(=O)[C@H]1[C@H]2C(=O)N([C@@H](CO)[C@@H](C)CC)C(C(=O)Nc3cc(C)ccc3C)C23CC(Br)[C@@H]1S3 |
| InChI | InChI=1S/C27H38BrN3O4S/c1-6-10-29-24(33)20-21-26(35)31(19(13-32)15(4)7-2)23(27(21)12-17(28)22(20)36-27)25(34)30-18-11-14(3)8-9-16(18)5/h8-9,11,15,17,19-23,32H,6-7,10,12-13H2,1-5H3,(H,29,33)(H,30,34)/t15-,17?,19-,20-,21-,22-,23?,27?/m0/s1 |
| InChIKey | GGCKPUWUIWUQHA-HHAXABIDSA-N |
| XLogP | 3.64 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.59 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|