C26H35BrN2O5S — CID 23950696
ethyl (5S,6S,7S)-8-bromo-2-[(2,5-dimethylphenyl)carbamoyl]-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23950696) has the molecular formula C26H35BrN2O5S and a molecular weight of 567.55 g/mol. Its IUPAC name is ethyl (5S,6S,7S)-8-bromo-2-[(2,5-dimethylphenyl)carbamoyl]-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (5S,6S,7S)-8-bromo-2-[(2,5-dimethylphenyl)carbamoyl]-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23950696 |
| Molecular Formula | C26H35BrN2O5S |
| Molecular Weight | 567.55 g/mol |
| Exact Mass | 566.15 |
| IUPAC Name | ethyl (5S,6S,7S)-8-bromo-2-[(2,5-dimethylphenyl)carbamoyl]-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H]2SC3(CC2Br)C(C(=O)Nc2cc(C)ccc2C)N([C@@H](CO)CC(C)C)C(=O)[C@H]13 |
| InChI | InChI=1S/C26H35BrN2O5S/c1-6-34-25(33)19-20-24(32)29(16(12-30)9-13(2)3)22(26(20)11-17(27)21(19)35-26)23(31)28-18-10-14(4)7-8-15(18)5/h7-8,10,13,16-17,19-22,30H,6,9,11-12H2,1-5H3,(H,28,31)/t16-,17?,19-,20+,21-,22?,26?/m1/s1 |
| InChIKey | SYRLLJOKFBTMSX-VVASSHFGSA-N |
| XLogP | 3.68 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.55 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|