C29H34N2O5S — CID 23809852
ethyl (5S,6R,7S)-2-[(2,5-dimethylphenyl)carbamoyl]-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23809852) has the molecular formula C29H34N2O5S and a molecular weight of 522.67 g/mol. Its IUPAC name is ethyl (5S,6R,7S)-2-[(2,5-dimethylphenyl)carbamoyl]-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (5S,6R,7S)-2-[(2,5-dimethylphenyl)carbamoyl]-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23809852 |
| Molecular Formula | C29H34N2O5S |
| Molecular Weight | 522.67 g/mol |
| Exact Mass | 522.22 |
| IUPAC Name | ethyl (5S,6R,7S)-2-[(2,5-dimethylphenyl)carbamoyl]-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H]2CCC3(S2)C(C(=O)Nc2cc(C)ccc2C)N([C@@H](CO)Cc2ccccc2)C(=O)[C@H]13 |
| InChI | InChI=1S/C29H34N2O5S/c1-4-36-28(35)23-22-12-13-29(37-22)24(23)27(34)31(20(16-32)15-19-8-6-5-7-9-19)25(29)26(33)30-21-14-17(2)10-11-18(21)3/h5-11,14,20,22-25,32H,4,12-13,15-16H2,1-3H3,(H,30,33)/t20-,22+,23-,24+,25?,29?/m1/s1 |
| InChIKey | SJWSOHGYXULJTC-XZJNKWMISA-N |
| XLogP | 3.50 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.67 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |