C32H42N4O4S — CID 23980898
(5S,6R,7S)-6-N-benzyl-2-N-[4-(diethylamino)phenyl]-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23980898) has the molecular formula C32H42N4O4S and a molecular weight of 578.78 g/mol. Its IUPAC name is (5S,6R,7S)-6-N-benzyl-2-N-[4-(diethylamino)phenyl]-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-6-N-benzyl-2-N-[4-(diethylamino)phenyl]-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23980898 |
| Molecular Formula | C32H42N4O4S |
| Molecular Weight | 578.78 g/mol |
| Exact Mass | 578.29 |
| IUPAC Name | (5S,6R,7S)-6-N-benzyl-2-N-[4-(diethylamino)phenyl]-3-[(2R)-1-hydroxy-3-methylbutan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)C2N([C@@H](CO)C(C)C)C(=O)[C@@H]3[C@H](C(=O)NCc4ccccc4)[C@@H]4CCC23S4)cc1 |
| InChI | InChI=1S/C32H42N4O4S/c1-5-35(6-2)23-14-12-22(13-15-23)34-30(39)28-32-17-16-25(41-32)26(29(38)33-18-21-10-8-7-9-11-21)27(32)31(40)36(28)24(19-37)20(3)4/h7-15,20,24-28,37H,5-6,16-19H2,1-4H3,(H,33,38)(H,34,39)/t24-,25-,26+,27-,28?,32?/m0/s1 |
| InChIKey | UNDMANDRPPLSTN-TYZIWRCXSA-N |
| XLogP | 3.90 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.78 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|