C27H30ClN3O5S — CID 23783435
(5S,6S,7R)-2-N-(2-chlorophenyl)-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23783435) has the molecular formula C27H30ClN3O5S and a molecular weight of 544.07 g/mol. Its IUPAC name is (5S,6S,7R)-2-N-(2-chlorophenyl)-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6S,7R)-2-N-(2-chlorophenyl)-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23783435 |
| Molecular Formula | C27H30ClN3O5S |
| Molecular Weight | 544.07 g/mol |
| Exact Mass | 543.16 |
| IUPAC Name | (5S,6S,7R)-2-N-(2-chlorophenyl)-6-N-(4-ethoxyphenyl)-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@@H]2[C@H]3C(=O)N([C@H](C)CO)C(C(=O)Nc4ccccc4Cl)C34CC[C@H]2S4)cc1 |
| InChI | InChI=1S/C27H30ClN3O5S/c1-3-36-17-10-8-16(9-11-17)29-24(33)21-20-12-13-27(37-20)22(21)26(35)31(15(2)14-32)23(27)25(34)30-19-7-5-4-6-18(19)28/h4-11,15,20-23,32H,3,12-14H2,1-2H3,(H,29,33)(H,30,34)/t15-,20-,21+,22+,23?,27?/m1/s1 |
| InChIKey | NWRFSVQGBUKPIO-HXLSYLMMSA-N |
| XLogP | 3.79 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.07 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |