C31H47N3O5 — CID 23896520
(5R,6S,7S)-6-N-benzyl-7-ethyl-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-2-N-(2,4,4-trimethylpentan-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23896520) has the molecular formula C31H47N3O5 and a molecular weight of 541.73 g/mol. Its IUPAC name is (5R,6S,7S)-6-N-benzyl-7-ethyl-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-2-N-(2,4,4-trimethylpentan-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-6-N-benzyl-7-ethyl-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-2-N-(2,4,4-trimethylpentan-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23896520 |
| Molecular Formula | C31H47N3O5 |
| Molecular Weight | 541.73 g/mol |
| Exact Mass | 541.35 |
| IUPAC Name | (5R,6S,7S)-6-N-benzyl-7-ethyl-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-2-N-(2,4,4-trimethylpentan-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CC[C@@H](CO)N1C(=O)[C@@H]2[C@H](C(=O)NCc3ccccc3)[C@]3(CC)CCC2(O3)C1C(=O)NC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C31H47N3O5/c1-8-21(18-35)34-24(26(37)33-29(6,7)19-28(3,4)5)31-16-15-30(9-2,39-31)22(23(31)27(34)38)25(36)32-17-20-13-11-10-12-14-20/h10-14,21-24,35H,8-9,15-19H2,1-7H3,(H,32,36)(H,33,37)/t21-,22+,23-,24?,30-,31?/m0/s1 |
| InChIKey | HQUDQCPPOXEGJR-FWKNKVHFSA-N |
| XLogP | 3.56 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.73 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |