C36H41N3O5 — CID 23782461
(5R,6S,7S)-6-N-benzyl-2-N-(2,6-dimethylphenyl)-7-ethyl-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23782461) has the molecular formula C36H41N3O5 and a molecular weight of 595.74 g/mol. Its IUPAC name is (5R,6S,7S)-6-N-benzyl-2-N-(2,6-dimethylphenyl)-7-ethyl-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-6-N-benzyl-2-N-(2,6-dimethylphenyl)-7-ethyl-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23782461 |
| Molecular Formula | C36H41N3O5 |
| Molecular Weight | 595.74 g/mol |
| Exact Mass | 595.30 |
| IUPAC Name | (5R,6S,7S)-6-N-benzyl-2-N-(2,6-dimethylphenyl)-7-ethyl-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CC[C@@]12CCC3(O1)C(C(=O)Nc1c(C)cccc1C)N([C@@H](CO)Cc1ccccc1)C(=O)[C@@H]3[C@@H]2C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C36H41N3O5/c1-4-35-18-19-36(44-35)29(28(35)32(41)37-21-26-16-9-6-10-17-26)34(43)39(27(22-40)20-25-14-7-5-8-15-25)31(36)33(42)38-30-23(2)12-11-13-24(30)3/h5-17,27-29,31,40H,4,18-22H2,1-3H3,(H,37,41)(H,38,42)/t27-,28-,29+,31?,35+,36?/m1/s1 |
| InChIKey | ROKWEIRLOBWVDE-LPOWSQFRSA-N |
| XLogP | 4.32 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.74 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |