C24H40N4O6 — CID 23782374
(5R,6S,7S)-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-6-N,7-dimethyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23782374) has the molecular formula C24H40N4O6 and a molecular weight of 480.61 g/mol. Its IUPAC name is (5R,6S,7S)-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-6-N,7-dimethyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-6-N,7-dimethyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23782374 |
| Molecular Formula | C24H40N4O6 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.29 |
| IUPAC Name | (5R,6S,7S)-3-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-6-N,7-dimethyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CC[C@H](C)[C@H](CO)N1C(=O)[C@@H]2[C@H](C(=O)NC)[C@]3(C)CCC2(O3)C1C(=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C24H40N4O6/c1-5-15(2)16(14-29)28-19(21(31)26-8-9-27-10-12-33-13-11-27)24-7-6-23(3,34-24)17(20(30)25-4)18(24)22(28)32/h15-19,29H,5-14H2,1-4H3,(H,25,30)(H,26,31)/t15-,16-,17+,18-,19?,23-,24?/m0/s1 |
| InChIKey | ZLDVAQUVRMOXJF-AVPCHVSASA-N |
| XLogP | -0.65 |
| TPSA | 120.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |