C34H46N4O5 — CID 23840613
(5R,6R,7R)-6-N-benzyl-2-N-[4-(diethylamino)phenyl]-7-ethyl-3-(5-hydroxypentyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23840613) has the molecular formula C34H46N4O5 and a molecular weight of 590.77 g/mol. Its IUPAC name is (5R,6R,7R)-6-N-benzyl-2-N-[4-(diethylamino)phenyl]-7-ethyl-3-(5-hydroxypentyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7R)-6-N-benzyl-2-N-[4-(diethylamino)phenyl]-7-ethyl-3-(5-hydroxypentyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23840613 |
| Molecular Formula | C34H46N4O5 |
| Molecular Weight | 590.77 g/mol |
| Exact Mass | 590.35 |
| IUPAC Name | (5R,6R,7R)-6-N-benzyl-2-N-[4-(diethylamino)phenyl]-7-ethyl-3-(5-hydroxypentyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)C2N(CCCCCO)C(=O)[C@@H]3[C@@H](C(=O)NCc4ccccc4)[C@@]4(CC)CCC23O4)cc1 |
| InChI | InChI=1S/C34H46N4O5/c1-4-33-19-20-34(43-33)28(27(33)30(40)35-23-24-13-9-7-10-14-24)32(42)38(21-11-8-12-22-39)29(34)31(41)36-25-15-17-26(18-16-25)37(5-2)6-3/h7,9-10,13-18,27-29,39H,4-6,8,11-12,19-23H2,1-3H3,(H,35,40)(H,36,41)/t27-,28-,29?,33+,34?/m0/s1 |
| InChIKey | APZBZCURSKLMRY-HWLIAIQJSA-N |
| XLogP | 4.11 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.77 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|