C27H47N3O5 — CID 23782542
(5R,6S,7S)-3-(5-hydroxypentyl)-7-methyl-4-oxo-6-N-propyl-2-N-(2,4,4-trimethylpentan-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23782542) has the molecular formula C27H47N3O5 and a molecular weight of 493.69 g/mol. Its IUPAC name is (5R,6S,7S)-3-(5-hydroxypentyl)-7-methyl-4-oxo-6-N-propyl-2-N-(2,4,4-trimethylpentan-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-3-(5-hydroxypentyl)-7-methyl-4-oxo-6-N-propyl-2-N-(2,4,4-trimethylpentan-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23782542 |
| Molecular Formula | C27H47N3O5 |
| Molecular Weight | 493.69 g/mol |
| Exact Mass | 493.35 |
| IUPAC Name | (5R,6S,7S)-3-(5-hydroxypentyl)-7-methyl-4-oxo-6-N-propyl-2-N-(2,4,4-trimethylpentan-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCCNC(=O)[C@H]1[C@H]2C(=O)N(CCCCCO)C(C(=O)NC(C)(C)CC(C)(C)C)C23CC[C@]1(C)O3 |
| InChI | InChI=1S/C27H47N3O5/c1-8-14-28-21(32)18-19-23(34)30(15-10-9-11-16-31)20(27(19)13-12-26(18,7)35-27)22(33)29-25(5,6)17-24(2,3)4/h18-20,31H,8-17H2,1-7H3,(H,28,32)(H,29,33)/t18-,19+,20?,26+,27?/m1/s1 |
| InChIKey | BWZVPRVWMCHDKC-CMLOLUQYSA-N |
| XLogP | 2.77 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.69 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|