C32H49N3O5 — CID 23924405
(5R,6S,7S)-6-N-benzyl-3-(6-hydroxyhexyl)-7-methyl-4-oxo-2-N-(2,4,4-trimethylpentan-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23924405) has the molecular formula C32H49N3O5 and a molecular weight of 555.76 g/mol. Its IUPAC name is (5R,6S,7S)-6-N-benzyl-3-(6-hydroxyhexyl)-7-methyl-4-oxo-2-N-(2,4,4-trimethylpentan-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-6-N-benzyl-3-(6-hydroxyhexyl)-7-methyl-4-oxo-2-N-(2,4,4-trimethylpentan-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23924405 |
| Molecular Formula | C32H49N3O5 |
| Molecular Weight | 555.76 g/mol |
| Exact Mass | 555.37 |
| IUPAC Name | (5R,6S,7S)-6-N-benzyl-3-(6-hydroxyhexyl)-7-methyl-4-oxo-2-N-(2,4,4-trimethylpentan-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CC(C)(C)CC(C)(C)NC(=O)C1N(CCCCCCO)C(=O)[C@@H]2[C@H](C(=O)NCc3ccccc3)[C@]3(C)CCC12O3 |
| InChI | InChI=1S/C32H49N3O5/c1-29(2,3)21-30(4,5)34-27(38)25-32-17-16-31(6,40-32)23(26(37)33-20-22-14-10-9-11-15-22)24(32)28(39)35(25)18-12-7-8-13-19-36/h9-11,14-15,23-25,36H,7-8,12-13,16-21H2,1-6H3,(H,33,37)(H,34,38)/t23-,24+,25?,31+,32?/m1/s1 |
| InChIKey | GZHLBOYVUAAHAB-BIMVKIMGSA-N |
| XLogP | 3.95 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.76 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|