C26H44N2O6 — CID 23809802
ethyl (5R,6S,7S)-7-ethyl-3-(4-hydroxybutyl)-4-oxo-2-(2,4,4-trimethylpentan-2-ylcarbamoyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23809802) has the molecular formula C26H44N2O6 and a molecular weight of 480.65 g/mol. Its IUPAC name is ethyl (5R,6S,7S)-7-ethyl-3-(4-hydroxybutyl)-4-oxo-2-(2,4,4-trimethylpentan-2-ylcarbamoyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (5R,6S,7S)-7-ethyl-3-(4-hydroxybutyl)-4-oxo-2-(2,4,4-trimethylpentan-2-ylcarbamoyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23809802 |
| Molecular Formula | C26H44N2O6 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.32 |
| IUPAC Name | ethyl (5R,6S,7S)-7-ethyl-3-(4-hydroxybutyl)-4-oxo-2-(2,4,4-trimethylpentan-2-ylcarbamoyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H]2C(=O)N(CCCCO)C(C(=O)NC(C)(C)CC(C)(C)C)C23CC[C@]1(CC)O3 |
| InChI | InChI=1S/C26H44N2O6/c1-8-25-12-13-26(34-25)17(18(25)22(32)33-9-2)21(31)28(14-10-11-15-29)19(26)20(30)27-24(6,7)16-23(3,4)5/h17-19,29H,8-16H2,1-7H3,(H,27,30)/t17-,18+,19?,25-,26?/m0/s1 |
| InChIKey | VKOVOYVCZAWNME-IQLRJMRGSA-N |
| XLogP | 2.81 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|