C38H47N3O7S — CID 145140606
2-[(1E,3E,5E)-5-[1-[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]-3,3,5-trimethylindol-2-ylidene]penta-1,3-dienyl]-1-ethyl-3,3-dimethyl-2H-indole-5-sulfonic acid (PubChem CID 145140606) has the molecular formula C38H47N3O7S and a molecular weight of 689.87 g/mol. Its IUPAC name is 2-[(1E,3E,5E)-5-[1-[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]-3,3,5-trimethylindol-2-ylidene]penta-1,3-dienyl]-1-ethyl-3,3-dimethyl-2H-indole-5-sulfonic acid.
| Compound Name | 2-[(1E,3E,5E)-5-[1-[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]-3,3,5-trimethylindol-2-ylidene]penta-1,3-dienyl]-1-ethyl-3,3-dimethyl-2H-indole-5-sulfonic acid |
|---|---|
| PubChem CID | 145140606 |
| Molecular Formula | C38H47N3O7S |
| Molecular Weight | 689.87 g/mol |
| Exact Mass | 689.31 |
| IUPAC Name | 2-[(1E,3E,5E)-5-[1-[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]-3,3,5-trimethylindol-2-ylidene]penta-1,3-dienyl]-1-ethyl-3,3-dimethyl-2H-indole-5-sulfonic acid |
| SMILES | CCN1c2ccc(S(=O)(=O)O)cc2C(C)(C)C1/C=C/C=C/C=C1/N(CCCCCC(=O)ON2C(=O)CCC2=O)c2ccc(C)cc2C1(C)C |
| InChI | InChI=1S/C38H47N3O7S/c1-7-39-30-20-18-27(49(45,46)47)25-29(30)38(5,6)32(39)14-10-8-11-15-33-37(3,4)28-24-26(2)17-19-31(28)40(33)23-13-9-12-16-36(44)48-41-34(42)21-22-35(41)43/h8,10-11,14-15,17-20,24-25,32H,7,9,12-13,16,21-23H2,1-6H3,(H,45,46,47)/b11-8+,14-10+,33-15+ |
| InChIKey | BMWPDEQIQKGXKL-YOEZMJSJSA-N |
| XLogP | 6.69 |
| TPSA | 124.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.87 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|