C32H38N3O9S+ — CID 73175578
1-[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]-2-[3-(1-ethyl-5-methoxycarbonylpyridin-1-ium-2-yl)prop-2-enylidene]-3,3-dimethylindole-5-sulfonic acid (PubChem CID 73175578) has the molecular formula C32H38N3O9S+ and a molecular weight of 640.74 g/mol. Its IUPAC name is 1-[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]-2-[3-(1-ethyl-5-methoxycarbonylpyridin-1-ium-2-yl)prop-2-enylidene]-3,3-dimethylindole-5-sulfonic acid.
| Compound Name | 1-[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]-2-[3-(1-ethyl-5-methoxycarbonylpyridin-1-ium-2-yl)prop-2-enylidene]-3,3-dimethylindole-5-sulfonic acid |
|---|---|
| PubChem CID | 73175578 |
| Molecular Formula | C32H38N3O9S+ |
| Molecular Weight | 640.74 g/mol |
| Exact Mass | 640.23 |
| IUPAC Name | 1-[6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexyl]-2-[3-(1-ethyl-5-methoxycarbonylpyridin-1-ium-2-yl)prop-2-enylidene]-3,3-dimethylindole-5-sulfonic acid |
| SMILES | CC[n+]1cc(C(=O)OC)ccc1C=CC=C1N(CCCCCC(=O)ON2C(=O)CCC2=O)c2ccc(S(=O)(=O)O)cc2C1(C)C |
| InChI | InChI=1S/C32H37N3O9S/c1-5-33-21-22(31(39)43-4)13-14-23(33)10-9-11-27-32(2,3)25-20-24(45(40,41)42)15-16-26(25)34(27)19-8-6-7-12-30(38)44-35-28(36)17-18-29(35)37/h9-11,13-16,20-21H,5-8,12,17-19H2,1-4H3/p+1 |
| InChIKey | XUKDYQDDNNYPLU-UHFFFAOYSA-O |
| XLogP | 3.89 |
| TPSA | 151.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.74 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|