C37H42N2O11S3 — CID 129078492
6-[2-[(1E,3E,5E)-5-[3,3-dimethyl-5-sulfo-1-(3-sulfophenyl)indol-2-ylidene]penta-1,3-dienyl]-3,3-dimethyl-5-sulfo-2H-indol-1-yl]hexanoic acid (PubChem CID 129078492) has the molecular formula C37H42N2O11S3 and a molecular weight of 786.95 g/mol. Its IUPAC name is 6-[2-[(1E,3E,5E)-5-[3,3-dimethyl-5-sulfo-1-(3-sulfophenyl)indol-2-ylidene]penta-1,3-dienyl]-3,3-dimethyl-5-sulfo-2H-indol-1-yl]hexanoic acid.
| Compound Name | 6-[2-[(1E,3E,5E)-5-[3,3-dimethyl-5-sulfo-1-(3-sulfophenyl)indol-2-ylidene]penta-1,3-dienyl]-3,3-dimethyl-5-sulfo-2H-indol-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 129078492 |
| Molecular Formula | C37H42N2O11S3 |
| Molecular Weight | 786.95 g/mol |
| Exact Mass | 786.20 |
| IUPAC Name | 6-[2-[(1E,3E,5E)-5-[3,3-dimethyl-5-sulfo-1-(3-sulfophenyl)indol-2-ylidene]penta-1,3-dienyl]-3,3-dimethyl-5-sulfo-2H-indol-1-yl]hexanoic acid |
| SMILES | CC1(C)/C(=C\C=C\C=C\C2N(CCCCCC(=O)O)c3ccc(S(=O)(=O)O)cc3C2(C)C)N(c2cccc(S(=O)(=O)O)c2)c2ccc(S(=O)(=O)O)cc21 |
| InChI | InChI=1S/C37H42N2O11S3/c1-36(2)29-23-27(52(45,46)47)17-19-31(29)38(21-10-6-9-16-35(40)41)33(36)14-7-5-8-15-34-37(3,4)30-24-28(53(48,49)50)18-20-32(30)39(34)25-12-11-13-26(22-25)51(42,43)44/h5,7-8,11-15,17-20,22-24,33H,6,9-10,16,21H2,1-4H3,(H,40,41)(H,42,43,44)(H,45,46,47)(H,48,49,50)/b8-5+,14-7+,34-15+ |
| InChIKey | PEHSGHWMBNIVAG-BBNOAEIYSA-N |
| XLogP | 6.66 |
| TPSA | 206.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.95 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|