C35H46N2O8S2 — CID 141316677
6-[(2E)-2-[(2E,4E,6E)-7-(1-ethyl-3,3-dimethyl-5-sulfo-2H-indol-2-yl)hepta-2,4,6-trienylidene]-3,3-dimethyl-5-sulfo-3a,4-dihydroindol-1-yl]hexanoic acid (PubChem CID 141316677) has the molecular formula C35H46N2O8S2 and a molecular weight of 686.89 g/mol. Its IUPAC name is 6-[(2E)-2-[(2E,4E,6E)-7-(1-ethyl-3,3-dimethyl-5-sulfo-2H-indol-2-yl)hepta-2,4,6-trienylidene]-3,3-dimethyl-5-sulfo-3a,4-dihydroindol-1-yl]hexanoic acid.
| Compound Name | 6-[(2E)-2-[(2E,4E,6E)-7-(1-ethyl-3,3-dimethyl-5-sulfo-2H-indol-2-yl)hepta-2,4,6-trienylidene]-3,3-dimethyl-5-sulfo-3a,4-dihydroindol-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 141316677 |
| Molecular Formula | C35H46N2O8S2 |
| Molecular Weight | 686.89 g/mol |
| Exact Mass | 686.27 |
| IUPAC Name | 6-[(2E)-2-[(2E,4E,6E)-7-(1-ethyl-3,3-dimethyl-5-sulfo-2H-indol-2-yl)hepta-2,4,6-trienylidene]-3,3-dimethyl-5-sulfo-3a,4-dihydroindol-1-yl]hexanoic acid |
| SMILES | CCN1c2ccc(S(=O)(=O)O)cc2C(C)(C)C1/C=C/C=C/C=C/C=C1/N(CCCCCC(=O)O)C2=CC=C(S(=O)(=O)O)CC2C1(C)C |
| InChI | InChI=1S/C35H46N2O8S2/c1-6-36-29-20-18-25(46(40,41)42)23-27(29)34(2,3)31(36)15-11-8-7-9-12-16-32-35(4,5)28-24-26(47(43,44)45)19-21-30(28)37(32)22-14-10-13-17-33(38)39/h7-9,11-12,15-16,18-21,23,28,31H,6,10,13-14,17,22,24H2,1-5H3,(H,38,39)(H,40,41,42)(H,43,44,45)/b8-7+,12-9+,15-11+,32-16+ |
| InChIKey | NHFDJSPGARPXKP-DVUOFFRMSA-N |
| XLogP | 6.63 |
| TPSA | 152.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.89 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|