C30H35N3O7S3 — CID 90243218
6-[(2E)-2-[(2E,4E)-5-[6-(dimethylsulfamoyl)-1,3-benzothiazol-2-yl]penta-2,4-dienylidene]-3,3-dimethyl-5-sulfoindol-1-yl]hexanoic acid (PubChem CID 90243218) has the molecular formula C30H35N3O7S3 and a molecular weight of 645.83 g/mol. Its IUPAC name is 6-[(2E)-2-[(2E,4E)-5-[6-(dimethylsulfamoyl)-1,3-benzothiazol-2-yl]penta-2,4-dienylidene]-3,3-dimethyl-5-sulfoindol-1-yl]hexanoic acid.
| Compound Name | 6-[(2E)-2-[(2E,4E)-5-[6-(dimethylsulfamoyl)-1,3-benzothiazol-2-yl]penta-2,4-dienylidene]-3,3-dimethyl-5-sulfoindol-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 90243218 |
| Molecular Formula | C30H35N3O7S3 |
| Molecular Weight | 645.83 g/mol |
| Exact Mass | 645.16 |
| IUPAC Name | 6-[(2E)-2-[(2E,4E)-5-[6-(dimethylsulfamoyl)-1,3-benzothiazol-2-yl]penta-2,4-dienylidene]-3,3-dimethyl-5-sulfoindol-1-yl]hexanoic acid |
| SMILES | CN(C)S(=O)(=O)c1ccc2nc(/C=C/C=C/C=C3/N(CCCCCC(=O)O)c4ccc(S(=O)(=O)O)cc4C3(C)C)sc2c1 |
| InChI | InChI=1S/C30H35N3O7S3/c1-30(2)23-19-22(43(38,39)40)15-17-25(23)33(18-10-6-9-13-29(34)35)27(30)11-7-5-8-12-28-31-24-16-14-21(20-26(24)41-28)42(36,37)32(3)4/h5,7-8,11-12,14-17,19-20H,6,9-10,13,18H2,1-4H3,(H,34,35)(H,38,39,40)/b7-5+,12-8+,27-11+ |
| InChIKey | IKFSEGBGPDSETF-FEYSXIAESA-N |
| XLogP | 5.69 |
| TPSA | 145.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.83 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|