C32H38N2O10S2 — CID 91403161
6-[2-[[3-[(3,3-dimethyl-5-sulfoindol-2-yl)methyl]-2-hydroxy-4-oxocyclobutyl]methylidene]-3,3-dimethyl-5-sulfoindol-1-yl]hexanoic acid (PubChem CID 91403161) has the molecular formula C32H38N2O10S2 and a molecular weight of 674.79 g/mol. Its IUPAC name is 6-[2-[[3-[(3,3-dimethyl-5-sulfoindol-2-yl)methyl]-2-hydroxy-4-oxocyclobutyl]methylidene]-3,3-dimethyl-5-sulfoindol-1-yl]hexanoic acid.
| Compound Name | 6-[2-[[3-[(3,3-dimethyl-5-sulfoindol-2-yl)methyl]-2-hydroxy-4-oxocyclobutyl]methylidene]-3,3-dimethyl-5-sulfoindol-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 91403161 |
| Molecular Formula | C32H38N2O10S2 |
| Molecular Weight | 674.79 g/mol |
| Exact Mass | 674.20 |
| IUPAC Name | 6-[2-[[3-[(3,3-dimethyl-5-sulfoindol-2-yl)methyl]-2-hydroxy-4-oxocyclobutyl]methylidene]-3,3-dimethyl-5-sulfoindol-1-yl]hexanoic acid |
| SMILES | CC1(C)C(CC2C(=O)C(C=C3N(CCCCCC(=O)O)c4ccc(S(=O)(=O)O)cc4C3(C)C)C2O)=Nc2ccc(S(=O)(=O)O)cc21 |
| InChI | InChI=1S/C32H38N2O10S2/c1-31(2)22-14-18(45(39,40)41)9-11-24(22)33-26(31)16-20-29(37)21(30(20)38)17-27-32(3,4)23-15-19(46(42,43)44)10-12-25(23)34(27)13-7-5-6-8-28(35)36/h9-12,14-15,17,20-21,29,37H,5-8,13,16H2,1-4H3,(H,35,36)(H,39,40,41)(H,42,43,44) |
| InChIKey | GWXSGSQQGHDWEI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 198.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.79 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|