C31H36N2O7S2 — CID 173274118
6-[2-[[3-[(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-2,4-dihydroxycyclobut-2-en-1-yl]methylidene]-3,3-dimethyl-5-sulfoindol-1-yl]hexanoic acid (PubChem CID 173274118) has the molecular formula C31H36N2O7S2 and a molecular weight of 612.77 g/mol. Its IUPAC name is 6-[2-[[3-[(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-2,4-dihydroxycyclobut-2-en-1-yl]methylidene]-3,3-dimethyl-5-sulfoindol-1-yl]hexanoic acid.
| Compound Name | 6-[2-[[3-[(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-2,4-dihydroxycyclobut-2-en-1-yl]methylidene]-3,3-dimethyl-5-sulfoindol-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 173274118 |
| Molecular Formula | C31H36N2O7S2 |
| Molecular Weight | 612.77 g/mol |
| Exact Mass | 612.20 |
| IUPAC Name | 6-[2-[[3-[(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-2,4-dihydroxycyclobut-2-en-1-yl]methylidene]-3,3-dimethyl-5-sulfoindol-1-yl]hexanoic acid |
| SMILES | CCN1C(=CC2=C(O)C(C=C3N(CCCCCC(=O)O)c4ccc(S(=O)(=O)O)cc4C3(C)C)C2O)Sc2ccccc21 |
| InChI | InChI=1S/C31H36N2O7S2/c1-4-32-24-10-7-8-11-25(24)41-27(32)18-21-29(36)20(30(21)37)17-26-31(2,3)22-16-19(42(38,39)40)13-14-23(22)33(26)15-9-5-6-12-28(34)35/h7-8,10-11,13-14,16-18,20,29,36-37H,4-6,9,12,15H2,1-3H3,(H,34,35)(H,38,39,40) |
| InChIKey | IZUBMCGKHXONFV-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 138.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.77 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|