C27H23N2O3- — CID 137167238
(5Z)-2-[(E)-(3,3-dimethyl-1H-indol-2-ylidene)methyl]-5-[(3,3-dimethylindol-2-yl)methylidene]-3,4-dioxocyclopenten-1-olate (PubChem CID 137167238) has the molecular formula C27H23N2O3- and a molecular weight of 423.49 g/mol. Its IUPAC name is (5Z)-2-[(E)-(3,3-dimethyl-1H-indol-2-ylidene)methyl]-5-[(3,3-dimethylindol-2-yl)methylidene]-3,4-dioxocyclopenten-1-olate.
| Compound Name | (5Z)-2-[(E)-(3,3-dimethyl-1H-indol-2-ylidene)methyl]-5-[(3,3-dimethylindol-2-yl)methylidene]-3,4-dioxocyclopenten-1-olate |
|---|---|
| PubChem CID | 137167238 |
| Molecular Formula | C27H23N2O3- |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | (5Z)-2-[(E)-(3,3-dimethyl-1H-indol-2-ylidene)methyl]-5-[(3,3-dimethylindol-2-yl)methylidene]-3,4-dioxocyclopenten-1-olate |
| SMILES | CC1(C)C(/C=C2\C(=O)C(=O)C(/C=C3/Nc4ccccc4C3(C)C)=C2[O-])=Nc2ccccc21 |
| InChI | InChI=1S/C27H24N2O3/c1-26(2)17-9-5-7-11-19(17)28-21(26)13-15-23(30)16(25(32)24(15)31)14-22-27(3,4)18-10-6-8-12-20(18)29-22/h5-14,28,30H,1-4H3/p-1/b16-14-,21-13+ |
| InChIKey | LPSNISBSJHTGQS-BAAIDKLTSA-M |
| XLogP | 4.03 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|