C30H26N2 — CID 101369644
4-[(E)-2-(3,3-dimethylindol-2-yl)ethenyl]-N,N-diphenylaniline (PubChem CID 101369644) has the molecular formula C30H26N2 and a molecular weight of 414.55 g/mol. Its IUPAC name is 4-[(E)-2-(3,3-dimethylindol-2-yl)ethenyl]-N,N-diphenylaniline.
| Compound Name | 4-[(E)-2-(3,3-dimethylindol-2-yl)ethenyl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 101369644 |
| Molecular Formula | C30H26N2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 4-[(E)-2-(3,3-dimethylindol-2-yl)ethenyl]-N,N-diphenylaniline |
| SMILES | CC1(C)C(/C=C/c2ccc(N(c3ccccc3)c3ccccc3)cc2)=Nc2ccccc21 |
| InChI | InChI=1S/C30H26N2/c1-30(2)27-15-9-10-16-28(27)31-29(30)22-19-23-17-20-26(21-18-23)32(24-11-5-3-6-12-24)25-13-7-4-8-14-25/h3-22H,1-2H3/b22-19+ |
| InChIKey | BAWRNVBGUABMQR-ZBJSNUHESA-N |
| XLogP | 8.23 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |