C30H27N2O3P — CID 89426483
[3,3-dimethyl-2-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]indol-5-yl]phosphonic acid (PubChem CID 89426483) has the molecular formula C30H27N2O3P and a molecular weight of 494.53 g/mol. Its IUPAC name is [3,3-dimethyl-2-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]indol-5-yl]phosphonic acid.
| Compound Name | [3,3-dimethyl-2-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]indol-5-yl]phosphonic acid |
|---|---|
| PubChem CID | 89426483 |
| Molecular Formula | C30H27N2O3P |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | [3,3-dimethyl-2-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]indol-5-yl]phosphonic acid |
| SMILES | CC1(C)C(/C=C/c2ccc(N(c3ccccc3)c3ccccc3)cc2)=Nc2ccc(P(=O)(O)O)cc21 |
| InChI | InChI=1S/C30H27N2O3P/c1-30(2)27-21-26(36(33,34)35)18-19-28(27)31-29(30)20-15-22-13-16-25(17-14-22)32(23-9-5-3-6-10-23)24-11-7-4-8-12-24/h3-21H,1-2H3,(H2,33,34,35)/b20-15+ |
| InChIKey | OQINTQZFEXOEJN-HMMYKYKNSA-N |
| XLogP | 7.04 |
| TPSA | 73.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|