About 2-[(E)-2-(2-methoxyphenyl)ethenyl]-3,3-dimethylindole
2-[(E)-2-(2-methoxyphenyl)ethenyl]-3,3-dimethylindole (PubChem CID 71656290) has the molecular formula C19H19NO
and a molecular weight of 277.37 g/mol. Its IUPAC name is 2-[(E)-2-(2-methoxyphenyl)ethenyl]-3,3-dimethylindole.
Molecular Properties
| Compound Name | 2-[(E)-2-(2-methoxyphenyl)ethenyl]-3,3-dimethylindole |
| PubChem CID | 71656290 |
| Molecular Formula | C19H19NO |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 2-[(E)-2-(2-methoxyphenyl)ethenyl]-3,3-dimethylindole |
| SMILES | COc1ccccc1/C=C/C1=Nc2ccccc2C1(C)C |
| InChI | InChI=1S/C19H19NO/c1-19(2)15-9-5-6-10-16(15)20-18(19)13-12-14-8-4-7-11-17(14)21-3/h4-13H,1-3H3/b13-12+ |
| InChIKey | HYWOKWFRLSEKKX-OUKQBFOZSA-N |
| XLogP | 4.77 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(E)-2-(2-methoxyphenyl)ethenyl]-3,3-dimethylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-2-(2-methoxyphenyl)ethenyl]-3,3-dimethylindole?
The IUPAC name of 2-[(E)-2-(2-methoxyphenyl)ethenyl]-3,3-dimethylindole (CID 71656290) is 2-[(E)-2-(2-methoxyphenyl)ethenyl]-3,3-dimethylindole.
What is the SMILES notation for 2-[(E)-2-(2-methoxyphenyl)ethenyl]-3,3-dimethylindole?
The canonical SMILES for 2-[(E)-2-(2-methoxyphenyl)ethenyl]-3,3-dimethylindole is COc1ccccc1/C=C/C1=Nc2ccccc2C1(C)C.
What is the InChIKey of 2-[(E)-2-(2-methoxyphenyl)ethenyl]-3,3-dimethylindole?
The InChIKey is HYWOKWFRLSEKKX-OUKQBFOZSA-N. The full InChI is InChI=1S/C19H19NO/c1-19(2)15-9-5-6-10-16(15)20-18(19)13-12-14-8-4-7-11-17(14)21-3/h4-13H,1-3H3/b13-12+.
What are the key properties of 2-[(E)-2-(2-methoxyphenyl)ethenyl]-3,3-dimethylindole?
2-[(E)-2-(2-methoxyphenyl)ethenyl]-3,3-dimethylindole has a molecular weight of 277.37 g/mol, XLogP of 4.77, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-2-(2-methoxyphenyl)ethenyl]-3,3-dimethylindole is sourced from PubChem (CID 71656290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).