C11H11BrO — CID 177481549
1-[(1E,3E)-4-bromobuta-1,3-dienyl]-2-methoxybenzene (PubChem CID 177481549) has the molecular formula C11H11BrO and a molecular weight of 239.11 g/mol. Its IUPAC name is 1-[(1E,3E)-4-bromobuta-1,3-dienyl]-2-methoxybenzene.
| Compound Name | 1-[(1E,3E)-4-bromobuta-1,3-dienyl]-2-methoxybenzene |
|---|---|
| PubChem CID | 177481549 |
| Molecular Formula | C11H11BrO |
| Molecular Weight | 239.11 g/mol |
| Exact Mass | 238.00 |
| IUPAC Name | 1-[(1E,3E)-4-bromobuta-1,3-dienyl]-2-methoxybenzene |
| SMILES | COc1ccccc1/C=C/C=C/Br |
| InChI | InChI=1S/C11H11BrO/c1-13-11-8-3-2-6-10(11)7-4-5-9-12/h2-9H,1H3/b7-4+,9-5+ |
| InChIKey | MFDFPGMMUPGQOY-XCIOYXGDSA-N |
| XLogP | 3.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.11 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|