C29H31N2O2+ — CID 23728459
2-[2,6-bis[(1E,3E)-4-(2-methoxyphenyl)buta-1,3-dienyl]pyridin-1-ium-1-yl]ethanamine (PubChem CID 23728459) has the molecular formula C29H31N2O2+ and a molecular weight of 439.58 g/mol. Its IUPAC name is 2-[2,6-bis[(1E,3E)-4-(2-methoxyphenyl)buta-1,3-dienyl]pyridin-1-ium-1-yl]ethanamine.
| Compound Name | 2-[2,6-bis[(1E,3E)-4-(2-methoxyphenyl)buta-1,3-dienyl]pyridin-1-ium-1-yl]ethanamine |
|---|---|
| PubChem CID | 23728459 |
| Molecular Formula | C29H31N2O2+ |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | 2-[2,6-bis[(1E,3E)-4-(2-methoxyphenyl)buta-1,3-dienyl]pyridin-1-ium-1-yl]ethanamine |
| SMILES | COc1ccccc1/C=C/C=C/c1cccc(/C=C/C=C/c2ccccc2OC)[n+]1CCN |
| InChI | InChI=1S/C29H31N2O2/c1-32-28-20-9-5-14-24(28)12-3-7-16-26-18-11-19-27(31(26)23-22-30)17-8-4-13-25-15-6-10-21-29(25)33-2/h3-21H,22-23,30H2,1-2H3/q+1/b12-3+,13-4+,16-7+,17-8+ |
| InChIKey | CEHWNAAHGDPEQZ-MRACVALQSA-N |
| XLogP | 5.40 |
| TPSA | 48.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|