C26H28O2 — CID 102152712
1-methoxy-3-[(1E,3E,5E)-6-(3-methoxy-2-prop-2-enylphenyl)hexa-1,3,5-trienyl]-2-prop-2-enylbenzene (PubChem CID 102152712) has the molecular formula C26H28O2 and a molecular weight of 372.51 g/mol. Its IUPAC name is 1-methoxy-3-[(1E,3E,5E)-6-(3-methoxy-2-prop-2-enylphenyl)hexa-1,3,5-trienyl]-2-prop-2-enylbenzene.
| Compound Name | 1-methoxy-3-[(1E,3E,5E)-6-(3-methoxy-2-prop-2-enylphenyl)hexa-1,3,5-trienyl]-2-prop-2-enylbenzene |
|---|---|
| PubChem CID | 102152712 |
| Molecular Formula | C26H28O2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | 1-methoxy-3-[(1E,3E,5E)-6-(3-methoxy-2-prop-2-enylphenyl)hexa-1,3,5-trienyl]-2-prop-2-enylbenzene |
| SMILES | C=CCc1c(/C=C/C=C/C=C/c2cccc(OC)c2CC=C)cccc1OC |
| InChI | InChI=1S/C26H28O2/c1-5-13-23-21(17-11-19-25(23)27-3)15-9-7-8-10-16-22-18-12-20-26(28-4)24(22)14-6-2/h5-12,15-20H,1-2,13-14H2,3-4H3/b8-7+,15-9+,16-10+ |
| InChIKey | LKPXKODMRDZTKA-ZLNLVZGMSA-N |
| XLogP | 6.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|