C27H28N2 — CID 101116695
2-[(1E,3E,5E,7Z)-7-(3,3-dimethyl-1H-indol-2-ylidene)hepta-1,3,5-trienyl]-3,3-dimethylindole (PubChem CID 101116695) has the molecular formula C27H28N2 and a molecular weight of 380.54 g/mol. Its IUPAC name is 2-[(1E,3E,5E,7Z)-7-(3,3-dimethyl-1H-indol-2-ylidene)hepta-1,3,5-trienyl]-3,3-dimethylindole.
| Compound Name | 2-[(1E,3E,5E,7Z)-7-(3,3-dimethyl-1H-indol-2-ylidene)hepta-1,3,5-trienyl]-3,3-dimethylindole |
|---|---|
| PubChem CID | 101116695 |
| Molecular Formula | C27H28N2 |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | 2-[(1E,3E,5E,7Z)-7-(3,3-dimethyl-1H-indol-2-ylidene)hepta-1,3,5-trienyl]-3,3-dimethylindole |
| SMILES | CC1(C)C(/C=C/C=C/C=C/C=C2\Nc3ccccc3C2(C)C)=Nc2ccccc21 |
| InChI | InChI=1S/C27H28N2/c1-26(2)20-14-10-12-16-22(20)28-24(26)18-8-6-5-7-9-19-25-27(3,4)21-15-11-13-17-23(21)29-25/h5-19,28H,1-4H3/b7-5+,8-6+,19-9+,24-18- |
| InChIKey | GGSNCZXVFUBNOD-GIWIMMKHSA-N |
| XLogP | 7.01 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|