C14H17N — CID 142032346
(2E)-2-[(E)-but-2-enylidene]-3,3-dimethyl-1H-indole (PubChem CID 142032346) has the molecular formula C14H17N and a molecular weight of 199.30 g/mol. Its IUPAC name is (2E)-2-[(E)-but-2-enylidene]-3,3-dimethyl-1H-indole.
| Compound Name | (2E)-2-[(E)-but-2-enylidene]-3,3-dimethyl-1H-indole |
|---|---|
| PubChem CID | 142032346 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | (2E)-2-[(E)-but-2-enylidene]-3,3-dimethyl-1H-indole |
| SMILES | C/C=C/C=C1/Nc2ccccc2C1(C)C |
| InChI | InChI=1S/C14H17N/c1-4-5-10-13-14(2,3)11-8-6-7-9-12(11)15-13/h4-10,15H,1-3H3/b5-4+,13-10+ |
| InChIKey | VZUWDTYWPVJKCY-VBJRVQAISA-N |
| XLogP | 3.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |