C13H13NSe — CID 139035352
4,4-dimethyl-9H-selenopheno[2,3-b]quinoline (PubChem CID 139035352) has the molecular formula C13H13NSe and a molecular weight of 262.21 g/mol. Its IUPAC name is 4,4-dimethyl-9H-selenopheno[2,3-b]quinoline.
| Compound Name | 4,4-dimethyl-9H-selenopheno[2,3-b]quinoline |
|---|---|
| PubChem CID | 139035352 |
| Molecular Formula | C13H13NSe |
| Molecular Weight | 262.21 g/mol |
| Exact Mass | 263.02 |
| IUPAC Name | 4,4-dimethyl-9H-selenopheno[2,3-b]quinoline |
| SMILES | CC1(C)c2ccccc2Nc2[se]ccc21 |
| InChI | InChI=1S/C13H13NSe/c1-13(2)9-5-3-4-6-11(9)14-12-10(13)7-8-15-12/h3-8,14H,1-2H3 |
| InChIKey | VBTXDJNIDQSBJF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.21 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|