C19H19Cl3N3O+ — CID 98206938
N-[(2R,3Z)-1,1,1-trichloro-3-(3,3-dimethyl-1H-indol-2-ylidene)propan-2-yl]pyridin-1-ium-1-carboxamide (PubChem CID 98206938) has the molecular formula C19H19Cl3N3O+ and a molecular weight of 411.74 g/mol. Its IUPAC name is N-[(2R,3Z)-1,1,1-trichloro-3-(3,3-dimethyl-1H-indol-2-ylidene)propan-2-yl]pyridin-1-ium-1-carboxamide.
| Compound Name | N-[(2R,3Z)-1,1,1-trichloro-3-(3,3-dimethyl-1H-indol-2-ylidene)propan-2-yl]pyridin-1-ium-1-carboxamide |
|---|---|
| PubChem CID | 98206938 |
| Molecular Formula | C19H19Cl3N3O+ |
| Molecular Weight | 411.74 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | N-[(2R,3Z)-1,1,1-trichloro-3-(3,3-dimethyl-1H-indol-2-ylidene)propan-2-yl]pyridin-1-ium-1-carboxamide |
| SMILES | CC1(C)/C(=C/[C@@H](NC(=O)[n+]2ccccc2)C(Cl)(Cl)Cl)Nc2ccccc21 |
| InChI | InChI=1S/C19H18Cl3N3O/c1-18(2)13-8-4-5-9-14(13)23-15(18)12-16(19(20,21)22)24-17(26)25-10-6-3-7-11-25/h3-12,16,23H,1-2H3/p+1/b15-12-/t16-/m1/s1 |
| InChIKey | YTAMOBZUKLNHRB-RTYFKUQISA-O |
| XLogP | 4.56 |
| TPSA | 45.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.74 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|