C12H14N2OS — CID 125489947
N-methyl-2-[(3R)-3-methyl-2-sulfanylidene-1H-indol-3-yl]acetamide (PubChem CID 125489947) has the molecular formula C12H14N2OS and a molecular weight of 234.32 g/mol. Its IUPAC name is N-methyl-2-[(3R)-3-methyl-2-sulfanylidene-1H-indol-3-yl]acetamide.
| Compound Name | N-methyl-2-[(3R)-3-methyl-2-sulfanylidene-1H-indol-3-yl]acetamide |
|---|---|
| PubChem CID | 125489947 |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | N-methyl-2-[(3R)-3-methyl-2-sulfanylidene-1H-indol-3-yl]acetamide |
| SMILES | CNC(=O)C[C@@]1(C)C(=S)Nc2ccccc21 |
| InChI | InChI=1S/C12H14N2OS/c1-12(7-10(15)13-2)8-5-3-4-6-9(8)14-11(12)16/h3-6H,7H2,1-2H3,(H,13,15)(H,14,16)/t12-/m1/s1 |
| InChIKey | KXKRTBOVNSLJIV-GFCCVEGCSA-N |
| XLogP | 1.83 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|