C10H9NS — CID 169168280
spiro[1H-indole-3,1'-cyclopropane]-2-thione (PubChem CID 169168280) has the molecular formula C10H9NS and a molecular weight of 175.26 g/mol. Its IUPAC name is spiro[1H-indole-3,1'-cyclopropane]-2-thione.
| Compound Name | spiro[1H-indole-3,1'-cyclopropane]-2-thione |
|---|---|
| PubChem CID | 169168280 |
| Molecular Formula | C10H9NS |
| Molecular Weight | 175.26 g/mol |
| Exact Mass | 175.05 |
| IUPAC Name | spiro[1H-indole-3,1'-cyclopropane]-2-thione |
| SMILES | S=C1Nc2ccccc2C12CC2 |
| InChI | InChI=1S/C10H9NS/c12-9-10(5-6-10)7-3-1-2-4-8(7)11-9/h1-4H,5-6H2,(H,11,12) |
| InChIKey | UVXVRWZSDHERAO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.26 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|