C37H40N2 — CID 144807194
2-[(E,6Z)-6-(1,1-dimethyl-3H-benzo[e]indol-2-ylidene)-2,5,5-trimethylhex-3-en-2-yl]-1,1-dimethylbenzo[e]indole (PubChem CID 144807194) has the molecular formula C37H40N2 and a molecular weight of 512.74 g/mol. Its IUPAC name is 2-[(E,6Z)-6-(1,1-dimethyl-3H-benzo[e]indol-2-ylidene)-2,5,5-trimethylhex-3-en-2-yl]-1,1-dimethylbenzo[e]indole.
| Compound Name | 2-[(E,6Z)-6-(1,1-dimethyl-3H-benzo[e]indol-2-ylidene)-2,5,5-trimethylhex-3-en-2-yl]-1,1-dimethylbenzo[e]indole |
|---|---|
| PubChem CID | 144807194 |
| Molecular Formula | C37H40N2 |
| Molecular Weight | 512.74 g/mol |
| Exact Mass | 512.32 |
| IUPAC Name | 2-[(E,6Z)-6-(1,1-dimethyl-3H-benzo[e]indol-2-ylidene)-2,5,5-trimethylhex-3-en-2-yl]-1,1-dimethylbenzo[e]indole |
| SMILES | CC(C)(/C=C1\Nc2ccc3ccccc3c2C1(C)C)/C=C/C(C)(C)C1=Nc2ccc3ccccc3c2C1(C)C |
| InChI | InChI=1S/C37H40N2/c1-34(2,23-30-36(5,6)31-26-15-11-9-13-24(26)17-19-28(31)38-30)21-22-35(3,4)33-37(7,8)32-27-16-12-10-14-25(27)18-20-29(32)39-33/h9-23,38H,1-8H3/b22-21+,30-23- |
| InChIKey | IZLTZAXGTUASQZ-HXGSDDGASA-N |
| XLogP | 10.25 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.74 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|