C21H25F6N2P — CID 161264270
N-[(E)-2-(3,3-dimethyl-1-propylindol-1-ium-2-yl)ethenyl]aniline hexafluorophosphate (PubChem CID 161264270) has the molecular formula C21H25F6N2P and a molecular weight of 450.41 g/mol. Its IUPAC name is N-[(E)-2-(3,3-dimethyl-1-propylindol-1-ium-2-yl)ethenyl]aniline hexafluorophosphate.
| Compound Name | N-[(E)-2-(3,3-dimethyl-1-propylindol-1-ium-2-yl)ethenyl]aniline hexafluorophosphate |
|---|---|
| PubChem CID | 161264270 |
| Molecular Formula | C21H25F6N2P |
| Molecular Weight | 450.41 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | N-[(E)-2-(3,3-dimethyl-1-propylindol-1-ium-2-yl)ethenyl]aniline hexafluorophosphate |
| SMILES | CCC[N+]1=C(/C=C/Nc2ccccc2)C(C)(C)c2ccccc21.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C21H24N2.F6P/c1-4-16-23-19-13-9-8-12-18(19)21(2,3)20(23)14-15-22-17-10-6-5-7-11-17;1-7(2,3,4,5)6/h5-15H,4,16H2,1-3H3;/q;-1/p+1 |
| InChIKey | XIALJMFTWUDNLU-UHFFFAOYSA-O |
| XLogP | 8.48 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.41 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|