C25H31N2+ — CID 59197364
(2Z)-1-ethyl-2-[(1-ethyl-3,3-dimethylindol-1-ium-2-yl)methylidene]-3,3-dimethylindole (PubChem CID 59197364) has the molecular formula C25H31N2+ and a molecular weight of 359.54 g/mol. Its IUPAC name is (2Z)-1-ethyl-2-[(1-ethyl-3,3-dimethylindol-1-ium-2-yl)methylidene]-3,3-dimethylindole.
| Compound Name | (2Z)-1-ethyl-2-[(1-ethyl-3,3-dimethylindol-1-ium-2-yl)methylidene]-3,3-dimethylindole |
|---|---|
| PubChem CID | 59197364 |
| Molecular Formula | C25H31N2+ |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | (2Z)-1-ethyl-2-[(1-ethyl-3,3-dimethylindol-1-ium-2-yl)methylidene]-3,3-dimethylindole |
| SMILES | CCN1/C(=C\C2=[N+](CC)c3ccccc3C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C25H31N2/c1-7-26-20-15-11-9-13-18(20)24(3,4)22(26)17-23-25(5,6)19-14-10-12-16-21(19)27(23)8-2/h9-17H,7-8H2,1-6H3/q+1 |
| InChIKey | FERVHVFVTLTTMN-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|