C30H32N2O2 — CID 177405876
3,4-bis[(E)-(1-ethyl-3,3-dimethylindol-2-ylidene)methyl]cyclobut-3-ene-1,2-dione (PubChem CID 177405876) has the molecular formula C30H32N2O2 and a molecular weight of 452.60 g/mol. Its IUPAC name is 3,4-bis[(E)-(1-ethyl-3,3-dimethylindol-2-ylidene)methyl]cyclobut-3-ene-1,2-dione.
| Compound Name | 3,4-bis[(E)-(1-ethyl-3,3-dimethylindol-2-ylidene)methyl]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 177405876 |
| Molecular Formula | C30H32N2O2 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | 3,4-bis[(E)-(1-ethyl-3,3-dimethylindol-2-ylidene)methyl]cyclobut-3-ene-1,2-dione |
| SMILES | CCN1/C(=C/c2c(/C=C3/N(CC)c4ccccc4C3(C)C)c(=O)c2=O)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C30H32N2O2/c1-7-31-23-15-11-9-13-21(23)29(3,4)25(31)17-19-20(28(34)27(19)33)18-26-30(5,6)22-14-10-12-16-24(22)32(26)8-2/h9-18H,7-8H2,1-6H3/b25-17+,26-18+ |
| InChIKey | SSWAVSLXNOYQDF-RPCRKUJJSA-N |
| XLogP | 5.60 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|