C22H19NO3 — CID 89433108
3-[(E)-(1-benzyl-3,3-dimethylindol-2-ylidene)methyl]-4-hydroxycyclobut-3-ene-1,2-dione (PubChem CID 89433108) has the molecular formula C22H19NO3 and a molecular weight of 345.40 g/mol. Its IUPAC name is 3-[(E)-(1-benzyl-3,3-dimethylindol-2-ylidene)methyl]-4-hydroxycyclobut-3-ene-1,2-dione.
| Compound Name | 3-[(E)-(1-benzyl-3,3-dimethylindol-2-ylidene)methyl]-4-hydroxycyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 89433108 |
| Molecular Formula | C22H19NO3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 3-[(E)-(1-benzyl-3,3-dimethylindol-2-ylidene)methyl]-4-hydroxycyclobut-3-ene-1,2-dione |
| SMILES | CC1(C)/C(=C\c2c(O)c(=O)c2=O)N(Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C22H19NO3/c1-22(2)16-10-6-7-11-17(16)23(13-14-8-4-3-5-9-14)18(22)12-15-19(24)21(26)20(15)25/h3-12,24H,13H2,1-2H3/b18-12+ |
| InChIKey | JZBRNYYZNWEUJG-LDADJPATSA-N |
| XLogP | 3.33 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|