C18H18N2O9S2 — CID 58594434
(2Z)-2-[(2-hydroxy-3,4-dioxocyclobuten-1-yl)methylidene]-1-[2-(methanesulfonamido)-2-oxoethyl]-3,3-dimethylindole-5-sulfonic acid (PubChem CID 58594434) has the molecular formula C18H18N2O9S2 and a molecular weight of 470.48 g/mol. Its IUPAC name is (2Z)-2-[(2-hydroxy-3,4-dioxocyclobuten-1-yl)methylidene]-1-[2-(methanesulfonamido)-2-oxoethyl]-3,3-dimethylindole-5-sulfonic acid.
| Compound Name | (2Z)-2-[(2-hydroxy-3,4-dioxocyclobuten-1-yl)methylidene]-1-[2-(methanesulfonamido)-2-oxoethyl]-3,3-dimethylindole-5-sulfonic acid |
|---|---|
| PubChem CID | 58594434 |
| Molecular Formula | C18H18N2O9S2 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.05 |
| IUPAC Name | (2Z)-2-[(2-hydroxy-3,4-dioxocyclobuten-1-yl)methylidene]-1-[2-(methanesulfonamido)-2-oxoethyl]-3,3-dimethylindole-5-sulfonic acid |
| SMILES | CC1(C)/C(=C/c2c(O)c(=O)c2=O)N(CC(=O)NS(C)(=O)=O)c2ccc(S(=O)(=O)O)cc21 |
| InChI | InChI=1S/C18H18N2O9S2/c1-18(2)11-6-9(31(27,28)29)4-5-12(11)20(8-14(21)19-30(3,25)26)13(18)7-10-15(22)17(24)16(10)23/h4-7,22H,8H2,1-3H3,(H,19,21)(H,27,28,29)/b13-7- |
| InChIKey | QYTKNMXGJOUOLK-QPEQYQDCSA-N |
| XLogP | -0.55 |
| TPSA | 175.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|