C29H35NO3S — CID 58489244
3-[(E)-[5-(5-tert-butylthiophen-2-yl)-1-hexyl-3,3-dimethylindol-2-ylidene]methyl]-4-hydroxycyclobut-3-ene-1,2-dione (PubChem CID 58489244) has the molecular formula C29H35NO3S and a molecular weight of 477.67 g/mol. Its IUPAC name is 3-[(E)-[5-(5-tert-butylthiophen-2-yl)-1-hexyl-3,3-dimethylindol-2-ylidene]methyl]-4-hydroxycyclobut-3-ene-1,2-dione.
| Compound Name | 3-[(E)-[5-(5-tert-butylthiophen-2-yl)-1-hexyl-3,3-dimethylindol-2-ylidene]methyl]-4-hydroxycyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 58489244 |
| Molecular Formula | C29H35NO3S |
| Molecular Weight | 477.67 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | 3-[(E)-[5-(5-tert-butylthiophen-2-yl)-1-hexyl-3,3-dimethylindol-2-ylidene]methyl]-4-hydroxycyclobut-3-ene-1,2-dione |
| SMILES | CCCCCCN1/C(=C/c2c(O)c(=O)c2=O)C(C)(C)c2cc(-c3ccc(C(C)(C)C)s3)ccc21 |
| InChI | InChI=1S/C29H35NO3S/c1-7-8-9-10-15-30-21-12-11-18(22-13-14-24(34-22)28(2,3)4)16-20(21)29(5,6)23(30)17-19-25(31)27(33)26(19)32/h11-14,16-17,31H,7-10,15H2,1-6H3/b23-17+ |
| InChIKey | ABAZWQOULJSKIJ-HAVVHWLPSA-N |
| XLogP | 6.73 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.67 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|