C30H42N3O2S+ — CID 59916900
1-ethyl-2-[(1-heptyl-3,3-dimethyl-5-methylsulfonylindol-2-ylidene)methyl]-3,3-dimethylpyrrolo[2,3-b]pyridin-1-ium (PubChem CID 59916900) has the molecular formula C30H42N3O2S+ and a molecular weight of 508.75 g/mol. Its IUPAC name is 1-ethyl-2-[(1-heptyl-3,3-dimethyl-5-methylsulfonylindol-2-ylidene)methyl]-3,3-dimethylpyrrolo[2,3-b]pyridin-1-ium.
| Compound Name | 1-ethyl-2-[(1-heptyl-3,3-dimethyl-5-methylsulfonylindol-2-ylidene)methyl]-3,3-dimethylpyrrolo[2,3-b]pyridin-1-ium |
|---|---|
| PubChem CID | 59916900 |
| Molecular Formula | C30H42N3O2S+ |
| Molecular Weight | 508.75 g/mol |
| Exact Mass | 508.30 |
| IUPAC Name | 1-ethyl-2-[(1-heptyl-3,3-dimethyl-5-methylsulfonylindol-2-ylidene)methyl]-3,3-dimethylpyrrolo[2,3-b]pyridin-1-ium |
| SMILES | CCCCCCCN1C(=CC2=[N+](CC)c3ncccc3C2(C)C)C(C)(C)c2cc(S(C)(=O)=O)ccc21 |
| InChI | InChI=1S/C30H42N3O2S/c1-8-10-11-12-13-19-33-25-17-16-22(36(7,34)35)20-24(25)30(5,6)27(33)21-26-29(3,4)23-15-14-18-31-28(23)32(26)9-2/h14-18,20-21H,8-13,19H2,1-7H3/q+1 |
| InChIKey | YCCBJFKAMXBPHE-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 53.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.75 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|