C40H56N2O4S — CID 88680443
1-hexyl-2-[7-(1-hexyl-3,3-dimethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]-3,3-dimethylindole;methyl sulfate (PubChem CID 88680443) has the molecular formula C40H56N2O4S and a molecular weight of 660.97 g/mol. Its IUPAC name is 1-hexyl-2-[7-(1-hexyl-3,3-dimethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]-3,3-dimethylindole;methyl sulfate.
| Compound Name | 1-hexyl-2-[7-(1-hexyl-3,3-dimethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]-3,3-dimethylindole;methyl sulfate |
|---|---|
| PubChem CID | 88680443 |
| Molecular Formula | C40H56N2O4S |
| Molecular Weight | 660.97 g/mol |
| Exact Mass | 660.40 |
| IUPAC Name | 1-hexyl-2-[7-(1-hexyl-3,3-dimethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]-3,3-dimethylindole;methyl sulfate |
| SMILES | CCCCCCN1C(=CC=CC=CC=CC2=[N+](CCCCCC)c3ccccc3C2(C)C)C(C)(C)c2ccccc21.COS(=O)(=O)[O-] |
| InChI | InChI=1S/C39H53N2.CH4O4S/c1-7-9-11-22-30-40-34-26-20-18-24-32(34)38(3,4)36(40)28-16-14-13-15-17-29-37-39(5,6)33-25-19-21-27-35(33)41(37)31-23-12-10-8-2;1-5-6(2,3)4/h13-21,24-29H,7-12,22-23,30-31H2,1-6H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | LYPSUDVOCUCCPO-UHFFFAOYSA-M |
| XLogP | 9.67 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.97 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|