C33H38N4O3 — CID 88817000
5-[(1E,3E)-1,3-bis(1,3,3-trimethylindol-2-ylidene)propan-2-ylidene]-1,3-diethyl-1,3-diazinane-2,4,6-trione (PubChem CID 88817000) has the molecular formula C33H38N4O3 and a molecular weight of 538.69 g/mol. Its IUPAC name is 5-[(1E,3E)-1,3-bis(1,3,3-trimethylindol-2-ylidene)propan-2-ylidene]-1,3-diethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(1E,3E)-1,3-bis(1,3,3-trimethylindol-2-ylidene)propan-2-ylidene]-1,3-diethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 88817000 |
| Molecular Formula | C33H38N4O3 |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.29 |
| IUPAC Name | 5-[(1E,3E)-1,3-bis(1,3,3-trimethylindol-2-ylidene)propan-2-ylidene]-1,3-diethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCN1C(=O)C(=C(/C=C2/N(C)c3ccccc3C2(C)C)/C=C2/N(C)c3ccccc3C2(C)C)C(=O)N(CC)C1=O |
| InChI | InChI=1S/C33H38N4O3/c1-9-36-29(38)28(30(39)37(10-2)31(36)40)21(19-26-32(3,4)22-15-11-13-17-24(22)34(26)7)20-27-33(5,6)23-16-12-14-18-25(23)35(27)8/h11-20H,9-10H2,1-8H3/b26-19+,27-20+ |
| InChIKey | ZJZGQMZVAKEQEY-VCNVVWDHSA-N |
| XLogP | 5.74 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|