C30H33N3OS2 — CID 88804107
5-[1,3-bis(1,3,3-trimethylindol-2-ylidene)propan-2-ylidene]-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 88804107) has the molecular formula C30H33N3OS2 and a molecular weight of 515.75 g/mol. Its IUPAC name is 5-[1,3-bis(1,3,3-trimethylindol-2-ylidene)propan-2-ylidene]-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[1,3-bis(1,3,3-trimethylindol-2-ylidene)propan-2-ylidene]-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 88804107 |
| Molecular Formula | C30H33N3OS2 |
| Molecular Weight | 515.75 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | 5-[1,3-bis(1,3,3-trimethylindol-2-ylidene)propan-2-ylidene]-3-ethyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)C(=C(C=C2N(C)c3ccccc3C2(C)C)C=C2N(C)c3ccccc3C2(C)C)SC1=S |
| InChI | InChI=1S/C30H33N3OS2/c1-8-33-27(34)26(36-28(33)35)19(17-24-29(2,3)20-13-9-11-15-22(20)31(24)6)18-25-30(4,5)21-14-10-12-16-23(21)32(25)7/h9-18H,8H2,1-7H3 |
| InChIKey | TVCQMKHDSXCIBQ-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.75 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|