C33H40N3O+ — CID 58915149
3-(butylamino)-2-[(1-ethyl-3,3-dimethylindol-2-ylidene)methyl]-4-[(1,3,3-trimethylindol-1-ium-2-yl)methylidene]cyclobut-2-en-1-one (PubChem CID 58915149) has the molecular formula C33H40N3O+ and a molecular weight of 494.70 g/mol. Its IUPAC name is 3-(butylamino)-2-[(1-ethyl-3,3-dimethylindol-2-ylidene)methyl]-4-[(1,3,3-trimethylindol-1-ium-2-yl)methylidene]cyclobut-2-en-1-one.
| Compound Name | 3-(butylamino)-2-[(1-ethyl-3,3-dimethylindol-2-ylidene)methyl]-4-[(1,3,3-trimethylindol-1-ium-2-yl)methylidene]cyclobut-2-en-1-one |
|---|---|
| PubChem CID | 58915149 |
| Molecular Formula | C33H40N3O+ |
| Molecular Weight | 494.70 g/mol |
| Exact Mass | 494.32 |
| IUPAC Name | 3-(butylamino)-2-[(1-ethyl-3,3-dimethylindol-2-ylidene)methyl]-4-[(1,3,3-trimethylindol-1-ium-2-yl)methylidene]cyclobut-2-en-1-one |
| SMILES | CCCCNC1=C(C=C2N(CC)c3ccccc3C2(C)C)C(=O)C1=CC1=[N+](C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C33H39N3O/c1-8-10-19-34-30-22(20-28-32(3,4)24-15-11-13-17-26(24)35(28)7)31(37)23(30)21-29-33(5,6)25-16-12-14-18-27(25)36(29)9-2/h11-18,20-21H,8-10,19H2,1-7H3/p+1 |
| InChIKey | DUWCHJLMJGJQJL-UHFFFAOYSA-O |
| XLogP | 6.55 |
| TPSA | 35.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.70 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|