C25H28ClN2+ — CID 21118386
9-[(2Z)-2-(5-chloro-1,3,3-trimethylindol-2-ylidene)ethylidene]-1,2,3,4,4a,9a-hexahydrocarbazol-9-ium (PubChem CID 21118386) has the molecular formula C25H28ClN2+ and a molecular weight of 391.97 g/mol. Its IUPAC name is 9-[(2Z)-2-(5-chloro-1,3,3-trimethylindol-2-ylidene)ethylidene]-1,2,3,4,4a,9a-hexahydrocarbazol-9-ium.
| Compound Name | 9-[(2Z)-2-(5-chloro-1,3,3-trimethylindol-2-ylidene)ethylidene]-1,2,3,4,4a,9a-hexahydrocarbazol-9-ium |
|---|---|
| PubChem CID | 21118386 |
| Molecular Formula | C25H28ClN2+ |
| Molecular Weight | 391.97 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 9-[(2Z)-2-(5-chloro-1,3,3-trimethylindol-2-ylidene)ethylidene]-1,2,3,4,4a,9a-hexahydrocarbazol-9-ium |
| SMILES | CN1/C(=C\C=[N+]2\c3ccccc3C3CCCCC32)C(C)(C)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C25H28ClN2/c1-25(2)20-16-17(26)12-13-23(20)27(3)24(25)14-15-28-21-10-6-4-8-18(21)19-9-5-7-11-22(19)28/h4,6,8,10,12-16,19,22H,5,7,9,11H2,1-3H3/q+1 |
| InChIKey | KMXPNCUSXAXXFS-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.97 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|